About 1,4-diethyl-1,4-dioxidopiperazine-1,4-diium
1,4-diethyl-1,4-dioxidopiperazine-1,4-diium (PubChem CID 12930918) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is 1,4-diethyl-1,4-dioxidopiperazine-1,4-diium.
Molecular Properties
| Compound Name | 1,4-diethyl-1,4-dioxidopiperazine-1,4-diium |
| PubChem CID | 12930918 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1,4-diethyl-1,4-dioxidopiperazine-1,4-diium |
| SMILES | CC[N+]1([O-])CC[N+]([O-])(CC)CC1 |
| InChI | InChI=1S/C8H18N2O2/c1-3-9(11)5-7-10(12,4-2)8-6-9/h3-8H2,1-2H3 |
| InChIKey | YQLZJVOPNHNDGG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diethyl-1,4-dioxidopiperazine-1,4-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diethyl-1,4-dioxidopiperazine-1,4-diium?
The IUPAC name of 1,4-diethyl-1,4-dioxidopiperazine-1,4-diium (CID 12930918) is 1,4-diethyl-1,4-dioxidopiperazine-1,4-diium.
What is the SMILES notation for 1,4-diethyl-1,4-dioxidopiperazine-1,4-diium?
The canonical SMILES for 1,4-diethyl-1,4-dioxidopiperazine-1,4-diium is CC[N+]1([O-])CC[N+]([O-])(CC)CC1.
What is the InChIKey of 1,4-diethyl-1,4-dioxidopiperazine-1,4-diium?
The InChIKey is YQLZJVOPNHNDGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-3-9(11)5-7-10(12,4-2)8-6-9/h3-8H2,1-2H3.
What are the key properties of 1,4-diethyl-1,4-dioxidopiperazine-1,4-diium?
1,4-diethyl-1,4-dioxidopiperazine-1,4-diium has a molecular weight of 174.24 g/mol, XLogP of 0.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diethyl-1,4-dioxidopiperazine-1,4-diium is sourced from PubChem (CID 12930918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).