C7H13N3O2 — CID 129309650
2-(1,2-diaminoethyl)-4,4-dimethyl-1,3-oxazol-5-one (PubChem CID 129309650) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-(1,2-diaminoethyl)-4,4-dimethyl-1,3-oxazol-5-one.
| Compound Name | 2-(1,2-diaminoethyl)-4,4-dimethyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 129309650 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 2-(1,2-diaminoethyl)-4,4-dimethyl-1,3-oxazol-5-one |
| SMILES | CC1(C)N=C(C(N)CN)OC1=O |
| InChI | InChI=1S/C7H13N3O2/c1-7(2)6(11)12-5(10-7)4(9)3-8/h4H,3,8-9H2,1-2H3 |
| InChIKey | WCDVCJYINCKFBB-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |