About 2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one
2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one (PubChem CID 129309688) has the molecular formula C7H11IN2O2
and a molecular weight of 282.08 g/mol. Its IUPAC name is 2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one |
| PubChem CID | 129309688 |
| Molecular Formula | C7H11IN2O2 |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one |
| SMILES | CC1(C)N=C(C(N)CI)OC1=O |
| InChI | InChI=1S/C7H11IN2O2/c1-7(2)6(11)12-5(10-7)4(9)3-8/h4H,3,9H2,1-2H3 |
| InChIKey | SRHWDZCIYYAKJD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one?
The IUPAC name of 2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one (CID 129309688) is 2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one.
What is the SMILES notation for 2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one?
The canonical SMILES for 2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one is CC1(C)N=C(C(N)CI)OC1=O.
What is the InChIKey of 2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one?
The InChIKey is SRHWDZCIYYAKJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11IN2O2/c1-7(2)6(11)12-5(10-7)4(9)3-8/h4H,3,9H2,1-2H3.
What are the key properties of 2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one?
2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one has a molecular weight of 282.08 g/mol, XLogP of 0.48, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-amino-2-iodoethyl)-4,4-dimethyl-1,3-oxazol-5-one is sourced from PubChem (CID 129309688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).