C14H18N6 — CID 129309700
N-[(3Z,5Z)-6-(methylamino)hexa-1,3,5-trien-2-yl]imino-N'-[(E)-(1-methyl-2-pyridinylidene)amino]methanimidamide (PubChem CID 129309700) has the molecular formula C14H18N6 and a molecular weight of 270.34 g/mol. Its IUPAC name is N-[(3Z,5Z)-6-(methylamino)hexa-1,3,5-trien-2-yl]imino-N'-[(E)-(1-methyl-2-pyridinylidene)amino]methanimidamide.
| Compound Name | N-[(3Z,5Z)-6-(methylamino)hexa-1,3,5-trien-2-yl]imino-N'-[(E)-(1-methyl-2-pyridinylidene)amino]methanimidamide |
|---|---|
| PubChem CID | 129309700 |
| Molecular Formula | C14H18N6 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | N-[(3Z,5Z)-6-(methylamino)hexa-1,3,5-trien-2-yl]imino-N'-[(E)-(1-methyl-2-pyridinylidene)amino]methanimidamide |
| SMILES | C=C(/C=C\C=C/NC)/N=N/C=N/N=c1\ccccn1C |
| InChI | InChI=1S/C14H18N6/c1-13(8-4-6-10-15-2)18-16-12-17-19-14-9-5-7-11-20(14)3/h4-12,15H,1H2,2-3H3/b8-4-,10-6-,17-12+,18-16+,19-14+ |
| InChIKey | OSCYAYASGSVKGT-KGOSITJPSA-N |
| XLogP | 2.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|