C15H33N — CID 129309764
N-ethyl-2,4,4,5,5,6-hexamethylheptan-2-amine (PubChem CID 129309764) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is N-ethyl-2,4,4,5,5,6-hexamethylheptan-2-amine.
| Compound Name | N-ethyl-2,4,4,5,5,6-hexamethylheptan-2-amine |
|---|---|
| PubChem CID | 129309764 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | N-ethyl-2,4,4,5,5,6-hexamethylheptan-2-amine |
| SMILES | CCNC(C)(C)CC(C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C15H33N/c1-10-16-14(6,7)11-13(4,5)15(8,9)12(2)3/h12,16H,10-11H2,1-9H3 |
| InChIKey | IHDCTUWYALWNBN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |