C21H32O3 — CID 129309996
2-methoxy-3,6-dimethyl-5-[(E)-2,5,7,7-tetramethyloct-4-en-2-yl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 129309996) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 2-methoxy-3,6-dimethyl-5-[(E)-2,5,7,7-tetramethyloct-4-en-2-yl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-methoxy-3,6-dimethyl-5-[(E)-2,5,7,7-tetramethyloct-4-en-2-yl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 129309996 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 2-methoxy-3,6-dimethyl-5-[(E)-2,5,7,7-tetramethyloct-4-en-2-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(C)C(=O)C(C(C)(C)C/C=C(\C)CC(C)(C)C)=C(C)C1=O |
| InChI | InChI=1S/C21H32O3/c1-13(12-20(4,5)6)10-11-21(7,8)16-14(2)18(23)19(24-9)15(3)17(16)22/h10H,11-12H2,1-9H3/b13-10+ |
| InChIKey | GEGMRPKKTAEDDC-JLHYYAGUSA-N |
| XLogP | 5.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|