C21H32FNO — CID 129310140
N-[(4E,6Z)-4,7-bis(ethenyl)-5-fluorodeca-1,4,6-trien-2-yl]-N-ethyloxan-4-amine (PubChem CID 129310140) has the molecular formula C21H32FNO and a molecular weight of 333.49 g/mol. Its IUPAC name is N-[(4E,6Z)-4,7-bis(ethenyl)-5-fluorodeca-1,4,6-trien-2-yl]-N-ethyloxan-4-amine.
| Compound Name | N-[(4E,6Z)-4,7-bis(ethenyl)-5-fluorodeca-1,4,6-trien-2-yl]-N-ethyloxan-4-amine |
|---|---|
| PubChem CID | 129310140 |
| Molecular Formula | C21H32FNO |
| Molecular Weight | 333.49 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | N-[(4E,6Z)-4,7-bis(ethenyl)-5-fluorodeca-1,4,6-trien-2-yl]-N-ethyloxan-4-amine |
| SMILES | C=C/C(=C\C(F)=C(/C=C)CC(=C)N(CC)C1CCOCC1)CCC |
| InChI | InChI=1S/C21H32FNO/c1-6-10-18(7-2)16-21(22)19(8-3)15-17(5)23(9-4)20-11-13-24-14-12-20/h7-8,16,20H,2-3,5-6,9-15H2,1,4H3/b18-16+,21-19- |
| InChIKey | QCCZSJYJXJAJSS-DHZPKXATSA-N |
| XLogP | 5.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|