C27H29ClFN5O7 — CID 129310227
2-[[4-[2-(4-chlorophenyl)ethyl]piperidin-1-yl]-hydroxymethoxy]-7-(4-fluoro-3-nitrobenzoyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 129310227) has the molecular formula C27H29ClFN5O7 and a molecular weight of 590.01 g/mol. Its IUPAC name is 2-[[4-[2-(4-chlorophenyl)ethyl]piperidin-1-yl]-hydroxymethoxy]-7-(4-fluoro-3-nitrobenzoyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | 2-[[4-[2-(4-chlorophenyl)ethyl]piperidin-1-yl]-hydroxymethoxy]-7-(4-fluoro-3-nitrobenzoyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 129310227 |
| Molecular Formula | C27H29ClFN5O7 |
| Molecular Weight | 590.01 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | 2-[[4-[2-(4-chlorophenyl)ethyl]piperidin-1-yl]-hydroxymethoxy]-7-(4-fluoro-3-nitrobenzoyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | O=C(c1ccc(F)c([N+](=O)[O-])c1)N1CCN2C(=O)N(OC(O)N3CCC(CCc4ccc(Cl)cc4)CC3)C(=O)C2C1 |
| InChI | InChI=1S/C27H29ClFN5O7/c28-20-6-3-17(4-7-20)1-2-18-9-11-30(12-10-18)27(38)41-33-25(36)23-16-31(13-14-32(23)26(33)37)24(35)19-5-8-21(29)22(15-19)34(39)40/h3-8,15,18,23,27,38H,1-2,9-14,16H2 |
| InChIKey | AGTJQWIJAZCBHV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 136.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.01 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|