C10H13N — CID 129310416
N-[(2E)-4-methylocta-2,4,5,7-tetraen-3-yl]methanimine (PubChem CID 129310416) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is N-[(2E)-4-methylocta-2,4,5,7-tetraen-3-yl]methanimine.
| Compound Name | N-[(2E)-4-methylocta-2,4,5,7-tetraen-3-yl]methanimine |
|---|---|
| PubChem CID | 129310416 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | N-[(2E)-4-methylocta-2,4,5,7-tetraen-3-yl]methanimine |
| SMILES | C=CC=C=C(C)/C(=C\C)N=C |
| InChI | InChI=1S/C10H13N/c1-5-7-8-9(3)10(6-2)11-4/h5-7H,1,4H2,2-3H3/b10-6+ |
| InChIKey | GEHUAXFJXCIOCX-UXBLZVDNSA-N |
| XLogP | 2.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|