C16H19N — CID 129310419
N-[(3E,6Z)-nona-1,3,6,8-tetraen-4-yl]cyclohepta-1,3,5-trien-1-amine (PubChem CID 129310419) has the molecular formula C16H19N and a molecular weight of 225.33 g/mol. Its IUPAC name is N-[(3E,6Z)-nona-1,3,6,8-tetraen-4-yl]cyclohepta-1,3,5-trien-1-amine.
| Compound Name | N-[(3E,6Z)-nona-1,3,6,8-tetraen-4-yl]cyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 129310419 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-[(3E,6Z)-nona-1,3,6,8-tetraen-4-yl]cyclohepta-1,3,5-trien-1-amine |
| SMILES | C=C/C=C\C/C(=C\C=C)NC1=CC=CC=CC1 |
| InChI | InChI=1S/C16H19N/c1-3-5-8-12-15(11-4-2)17-16-13-9-6-7-10-14-16/h3-11,13,17H,1-2,12,14H2/b8-5-,15-11+ |
| InChIKey | ABFCLCCCOGAXNN-JWSRNPNGSA-N |
| XLogP | 4.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|