C13H23N3O — CID 129310447
(3S,5R)-1-[(3E,5E)-6-methoxyhepta-1,3,5-trien-4-yl]piperidine-3,5-diamine (PubChem CID 129310447) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is (3S,5R)-1-[(3E,5E)-6-methoxyhepta-1,3,5-trien-4-yl]piperidine-3,5-diamine.
| Compound Name | (3S,5R)-1-[(3E,5E)-6-methoxyhepta-1,3,5-trien-4-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 129310447 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | (3S,5R)-1-[(3E,5E)-6-methoxyhepta-1,3,5-trien-4-yl]piperidine-3,5-diamine |
| SMILES | C=C/C=C(\C=C(/C)OC)N1C[C@H](N)C[C@H](N)C1 |
| InChI | InChI=1S/C13H23N3O/c1-4-5-13(6-10(2)17-3)16-8-11(14)7-12(15)9-16/h4-6,11-12H,1,7-9,14-15H2,2-3H3/b10-6+,13-5+/t11-,12+ |
| InChIKey | NGHCRKRSUMQAQY-ZKEYHEBZSA-N |
| XLogP | 0.97 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|