C14H29NO5 — CID 129310449
1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)butan-2-ol (PubChem CID 129310449) has the molecular formula C14H29NO5 and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)butan-2-ol.
| Compound Name | 1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)butan-2-ol |
|---|---|
| PubChem CID | 129310449 |
| Molecular Formula | C14H29NO5 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)butan-2-ol |
| SMILES | CCC(O)CN1CCOCCOCCOCCOCC1 |
| InChI | InChI=1S/C14H29NO5/c1-2-14(16)13-15-3-5-17-7-9-19-11-12-20-10-8-18-6-4-15/h14,16H,2-13H2,1H3 |
| InChIKey | GHYCYQVVLMBQRI-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |