C10H14N4 — CID 129310510
5-[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]-1,4-dihydropyrimidin-2-amine (PubChem CID 129310510) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]-1,4-dihydropyrimidin-2-amine.
| Compound Name | 5-[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]-1,4-dihydropyrimidin-2-amine |
|---|---|
| PubChem CID | 129310510 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 5-[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]-1,4-dihydropyrimidin-2-amine |
| SMILES | C=C(/C=C\C=C/N)C1=CNC(N)=NC1 |
| InChI | InChI=1S/C10H14N4/c1-8(4-2-3-5-11)9-6-13-10(12)14-7-9/h2-6H,1,7,11H2,(H3,12,13,14)/b4-2-,5-3- |
| InChIKey | PMVNPBCRKIHDMC-JVLMNHKTSA-N |
| XLogP | 0.37 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|