C42H46N2 — CID 129310603
2-[(1S)-24-(2,3-dihydropyridin-6-yl)-1,15,15,27,27-pentamethyl-12-hexacyclo[14.11.0.02,7.08,14.017,26.018,23]heptacosa-2,4,6,9,12,17(26),18(23),21,24-nonaenyl]-1,2-dihydropyridine (PubChem CID 129310603) has the molecular formula C42H46N2 and a molecular weight of 578.84 g/mol. Its IUPAC name is 2-[(1S)-24-(2,3-dihydropyridin-6-yl)-1,15,15,27,27-pentamethyl-12-hexacyclo[14.11.0.02,7.08,14.017,26.018,23]heptacosa-2,4,6,9,12,17(26),18(23),21,24-nonaenyl]-1,2-dihydropyridine.
| Compound Name | 2-[(1S)-24-(2,3-dihydropyridin-6-yl)-1,15,15,27,27-pentamethyl-12-hexacyclo[14.11.0.02,7.08,14.017,26.018,23]heptacosa-2,4,6,9,12,17(26),18(23),21,24-nonaenyl]-1,2-dihydropyridine |
|---|---|
| PubChem CID | 129310603 |
| Molecular Formula | C42H46N2 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.37 |
| IUPAC Name | 2-[(1S)-24-(2,3-dihydropyridin-6-yl)-1,15,15,27,27-pentamethyl-12-hexacyclo[14.11.0.02,7.08,14.017,26.018,23]heptacosa-2,4,6,9,12,17(26),18(23),21,24-nonaenyl]-1,2-dihydropyridine |
| SMILES | CC1(C)C2C=C(C3C=CC=CN3)CC=CC2c2ccccc2[C@@]2(C)C1c1c(cc(C3=NCCC=C3)c3c1CCC=C3)C2(C)C |
| InChI | InChI=1S/C42H46N2/c1-40(2)34-25-27(36-21-10-12-23-43-36)15-14-19-30(34)29-17-8-9-20-33(29)42(5)39(40)38-31-18-7-6-16-28(31)32(26-35(38)41(42,3)4)37-22-11-13-24-44-37/h6,8-12,14,16-17,19-23,25-26,30,34,36,39,43H,7,13,15,18,24H2,1-5H3/t30?,34?,36?,39?,42-/m0/s1 |
| InChIKey | QUAWYQHDRCWABC-NREYVPSSSA-N |
| XLogP | 9.40 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|