About 3-ethylbenzo[c][1,5]naphthyridine
3-ethylbenzo[c][1,5]naphthyridine (PubChem CID 129310998) has the molecular formula C14H12N2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-ethylbenzo[c][1,5]naphthyridine.
Molecular Properties
| Compound Name | 3-ethylbenzo[c][1,5]naphthyridine |
| PubChem CID | 129310998 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3-ethylbenzo[c][1,5]naphthyridine |
| SMILES | CCc1cnc2c(c1)ncc1ccccc12 |
| InChI | InChI=1S/C14H12N2/c1-2-10-7-13-14(16-8-10)12-6-4-3-5-11(12)9-15-13/h3-9H,2H2,1H3 |
| InChIKey | MZNJOSXSPHBPMN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylbenzo[c][1,5]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylbenzo[c][1,5]naphthyridine?
The IUPAC name of 3-ethylbenzo[c][1,5]naphthyridine (CID 129310998) is 3-ethylbenzo[c][1,5]naphthyridine.
What is the SMILES notation for 3-ethylbenzo[c][1,5]naphthyridine?
The canonical SMILES for 3-ethylbenzo[c][1,5]naphthyridine is CCc1cnc2c(c1)ncc1ccccc12.
What is the InChIKey of 3-ethylbenzo[c][1,5]naphthyridine?
The InChIKey is MZNJOSXSPHBPMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2/c1-2-10-7-13-14(16-8-10)12-6-4-3-5-11(12)9-15-13/h3-9H,2H2,1H3.
What are the key properties of 3-ethylbenzo[c][1,5]naphthyridine?
3-ethylbenzo[c][1,5]naphthyridine has a molecular weight of 208.26 g/mol, XLogP of 3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylbenzo[c][1,5]naphthyridine is sourced from PubChem (CID 129310998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).