C66H57N3 — CID 129311142
3-N-cyclohexa-1,3-dien-1-yl-1-N,3-N-bis(9,9-dimethylfluoren-2-yl)-1-N-phenyl-5-(9-phenyl-1,2,7,8-tetrahydrocarbazol-3-yl)benzene-1,3-diamine (PubChem CID 129311142) has the molecular formula C66H57N3 and a molecular weight of 892.20 g/mol. Its IUPAC name is 3-N-cyclohexa-1,3-dien-1-yl-1-N,3-N-bis(9,9-dimethylfluoren-2-yl)-1-N-phenyl-5-(9-phenyl-1,2,7,8-tetrahydrocarbazol-3-yl)benzene-1,3-diamine.
| Compound Name | 3-N-cyclohexa-1,3-dien-1-yl-1-N,3-N-bis(9,9-dimethylfluoren-2-yl)-1-N-phenyl-5-(9-phenyl-1,2,7,8-tetrahydrocarbazol-3-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 129311142 |
| Molecular Formula | C66H57N3 |
| Molecular Weight | 892.20 g/mol |
| Exact Mass | 891.46 |
| IUPAC Name | 3-N-cyclohexa-1,3-dien-1-yl-1-N,3-N-bis(9,9-dimethylfluoren-2-yl)-1-N-phenyl-5-(9-phenyl-1,2,7,8-tetrahydrocarbazol-3-yl)benzene-1,3-diamine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(C3=CC=CCC3)c3cc(C4=Cc5c6c(n(-c7ccccc7)c5CC4)CCC=C6)cc(N(c4ccccc4)c4ccc5c(c4)C(C)(C)c4ccccc4-5)c3)cc21 |
| InChI | InChI=1S/C66H57N3/c1-65(2)59-29-17-14-26-53(59)55-35-33-49(42-61(55)65)67(46-20-8-5-9-21-46)51-38-45(44-32-37-64-58(40-44)57-28-16-19-31-63(57)69(64)48-24-12-7-13-25-48)39-52(41-51)68(47-22-10-6-11-23-47)50-34-36-56-54-27-15-18-30-60(54)66(3,4)62(56)43-50/h5-10,12-18,20-22,24-30,33-36,38-43H,11,19,23,31-32,37H2,1-4H3 |
| InChIKey | KFGDWPYQOXVWSZ-UHFFFAOYSA-N |
| XLogP | 17.38 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.20 |
| LogP ≤ 5 | 17.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |