About (Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine
(Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine (PubChem CID 129311346) has the molecular formula C16H27N
and a molecular weight of 233.40 g/mol. Its IUPAC name is (Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine.
Molecular Properties
| Compound Name | (Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine |
| PubChem CID | 129311346 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine |
| SMILES | C=CC(=C)C(C)(C)CC/N=C/C=C\C(C)CC |
| InChI | InChI=1S/C16H27N/c1-7-14(3)10-9-12-17-13-11-16(5,6)15(4)8-2/h8-10,12,14H,2,4,7,11,13H2,1,3,5-6H3/b10-9-,17-12+ |
| InChIKey | RZKVUFCRHUEYKO-BOCOQIOWSA-N |
| XLogP | 4.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine?
The IUPAC name of (Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine (CID 129311346) is (Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine.
What is the SMILES notation for (Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine?
The canonical SMILES for (Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine is C=CC(=C)C(C)(C)CC/N=C/C=C\C(C)CC.
What is the InChIKey of (Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine?
The InChIKey is RZKVUFCRHUEYKO-BOCOQIOWSA-N. The full InChI is InChI=1S/C16H27N/c1-7-14(3)10-9-12-17-13-11-16(5,6)15(4)8-2/h8-10,12,14H,2,4,7,11,13H2,1,3,5-6H3/b10-9-,17-12+.
What are the key properties of (Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine?
(Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine has a molecular weight of 233.40 g/mol, XLogP of 4.82, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(3,3-dimethyl-4-methylidenehex-5-enyl)-4-methylhex-2-en-1-imine is sourced from PubChem (CID 129311346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).