C43H35N3 — CID 129311397
5-[7-(1,2-dihydropyridin-2-yl)-9,9-dimethylfluoren-2-yl]spiro[3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10-tetraene-8,9'-fluorene] (PubChem CID 129311397) has the molecular formula C43H35N3 and a molecular weight of 593.77 g/mol. Its IUPAC name is 5-[7-(1,2-dihydropyridin-2-yl)-9,9-dimethylfluoren-2-yl]spiro[3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10-tetraene-8,9'-fluorene].
| Compound Name | 5-[7-(1,2-dihydropyridin-2-yl)-9,9-dimethylfluoren-2-yl]spiro[3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10-tetraene-8,9'-fluorene] |
|---|---|
| PubChem CID | 129311397 |
| Molecular Formula | C43H35N3 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | 5-[7-(1,2-dihydropyridin-2-yl)-9,9-dimethylfluoren-2-yl]spiro[3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10-tetraene-8,9'-fluorene] |
| SMILES | CC1(C)c2cc(C3=CC4=C(NC3)C3=C(C=CCN3)C43c4ccccc4-c4ccccc43)ccc2-c2ccc(C3C=CC=CN3)cc21 |
| InChI | InChI=1S/C43H35N3/c1-42(2)36-22-26(16-18-31(36)32-19-17-27(23-37(32)42)39-15-7-8-20-44-39)28-24-38-41(46-25-28)40-35(14-9-21-45-40)43(38)33-12-5-3-10-29(33)30-11-4-6-13-34(30)43/h3-20,22-24,39,44-46H,21,25H2,1-2H3 |
| InChIKey | WMSXDKZRARJBDL-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |