C9H15NO — CID 129311525
(2Z,4E)-2,6-dimethylhepta-2,4-dienamide (PubChem CID 129311525) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (2Z,4E)-2,6-dimethylhepta-2,4-dienamide.
| Compound Name | (2Z,4E)-2,6-dimethylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 129311525 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (2Z,4E)-2,6-dimethylhepta-2,4-dienamide |
| SMILES | C/C(=C/C=C/C(C)C)C(N)=O |
| InChI | InChI=1S/C9H15NO/c1-7(2)5-4-6-8(3)9(10)11/h4-7H,1-3H3,(H2,10,11)/b5-4+,8-6- |
| InChIKey | HIHRGYHIDMATMJ-LMJRQTCTSA-N |
| XLogP | 1.63 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|