C29H36N6O2S — CID 129311607
1-[3-tert-butyl-5-(methylsulfanylamino)phenyl]-3-[4-[(1-ethanimidoyl-6-imino-3-pyridinyl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea (PubChem CID 129311607) has the molecular formula C29H36N6O2S and a molecular weight of 532.71 g/mol. Its IUPAC name is 1-[3-tert-butyl-5-(methylsulfanylamino)phenyl]-3-[4-[(1-ethanimidoyl-6-imino-3-pyridinyl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea.
| Compound Name | 1-[3-tert-butyl-5-(methylsulfanylamino)phenyl]-3-[4-[(1-ethanimidoyl-6-imino-3-pyridinyl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
|---|---|
| PubChem CID | 129311607 |
| Molecular Formula | C29H36N6O2S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 1-[3-tert-butyl-5-(methylsulfanylamino)phenyl]-3-[4-[(1-ethanimidoyl-6-imino-3-pyridinyl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
| SMILES | [H]/N=C(\C)n1cc(OC2CCC(NC(=O)Nc3cc(NSC)cc(C(C)(C)C)c3)c3ccccc32)cc/c1=N\[H] |
| InChI | InChI=1S/C29H36N6O2S/c1-18(30)35-17-22(10-13-27(35)31)37-26-12-11-25(23-8-6-7-9-24(23)26)33-28(36)32-20-14-19(29(2,3)4)15-21(16-20)34-38-5/h6-10,13-17,25-26,30-31,34H,11-12H2,1-5H3,(H2,32,33,36)/b30-18+,31-27+ |
| InChIKey | CAFBCDDRFWERBG-OXEXYJLXSA-N |
| XLogP | 6.58 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|