About (E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine
(E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine (PubChem CID 129312194) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is (E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine.
Molecular Properties
| Compound Name | (E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine |
| PubChem CID | 129312194 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine |
| SMILES | CN/C(C)=C/C1(C)CC=NC=C1C |
| InChI | InChI=1S/C11H18N2/c1-9-8-13-6-5-11(9,3)7-10(2)12-4/h6-8,12H,5H2,1-4H3/b10-7+ |
| InChIKey | DOZAJKUFVFZPFI-JXMROGBWSA-N |
| XLogP | 2.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine?
The IUPAC name of (E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine (CID 129312194) is (E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine.
What is the SMILES notation for (E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine?
The canonical SMILES for (E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine is CN/C(C)=C/C1(C)CC=NC=C1C.
What is the InChIKey of (E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine?
The InChIKey is DOZAJKUFVFZPFI-JXMROGBWSA-N. The full InChI is InChI=1S/C11H18N2/c1-9-8-13-6-5-11(9,3)7-10(2)12-4/h6-8,12H,5H2,1-4H3/b10-7+.
What are the key properties of (E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine?
(E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine has a molecular weight of 178.28 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(4,5-dimethyl-3H-pyridin-4-yl)-N-methylprop-1-en-2-amine is sourced from PubChem (CID 129312194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).