C13H15NS — CID 129312261
6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4H-azepine-2-thiol (PubChem CID 129312261) has the molecular formula C13H15NS and a molecular weight of 217.34 g/mol. Its IUPAC name is 6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4H-azepine-2-thiol.
| Compound Name | 6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4H-azepine-2-thiol |
|---|---|
| PubChem CID | 129312261 |
| Molecular Formula | C13H15NS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4H-azepine-2-thiol |
| SMILES | C=C/C(=C\C=C/C)C1=CCC=C(S)N=C1 |
| InChI | InChI=1S/C13H15NS/c1-3-5-7-11(4-2)12-8-6-9-13(15)14-10-12/h3-5,7-10,15H,2,6H2,1H3/b5-3-,11-7+ |
| InChIKey | TUELCHHWNDYTKD-HOTIPDSSSA-N |
| XLogP | 3.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|