C17H16N4 — CID 129312907
4-[1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 129312907) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-[1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-[1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 129312907 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-[1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C=C/C(=C\C=C/C)n1cc(-c2ccnc3[nH]ccc23)cn1 |
| InChI | InChI=1S/C17H16N4/c1-3-5-6-14(4-2)21-12-13(11-20-21)15-7-9-18-17-16(15)8-10-19-17/h3-12H,2H2,1H3,(H,18,19)/b5-3-,14-6+ |
| InChIKey | SLNDEDCVAFELEX-RGWZVXDZSA-N |
| XLogP | 4.03 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|