C24H39FO7 — CID 129313018
(4R,6R,8R,10R,12R,13R,14S,15R)-8-ethenyl-15-ethyl-4-fluoro-13,14-dihydroxy-8-methoxy-4,6,10,12,14-pentamethyl-oxacyclopentadecane-2,5,11-trione (PubChem CID 129313018) has the molecular formula C24H39FO7 and a molecular weight of 458.57 g/mol. Its IUPAC name is (4R,6R,8R,10R,12R,13R,14S,15R)-8-ethenyl-15-ethyl-4-fluoro-13,14-dihydroxy-8-methoxy-4,6,10,12,14-pentamethyl-oxacyclopentadecane-2,5,11-trione.
| Compound Name | (4R,6R,8R,10R,12R,13R,14S,15R)-8-ethenyl-15-ethyl-4-fluoro-13,14-dihydroxy-8-methoxy-4,6,10,12,14-pentamethyl-oxacyclopentadecane-2,5,11-trione |
|---|---|
| PubChem CID | 129313018 |
| Molecular Formula | C24H39FO7 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | (4R,6R,8R,10R,12R,13R,14S,15R)-8-ethenyl-15-ethyl-4-fluoro-13,14-dihydroxy-8-methoxy-4,6,10,12,14-pentamethyl-oxacyclopentadecane-2,5,11-trione |
| SMILES | C=C[C@@]1(OC)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@](C)(O)[C@@H](CC)OC(=O)C[C@@](C)(F)C(=O)[C@H](C)C1 |
| InChI | InChI=1S/C24H39FO7/c1-9-17-23(7,30)21(29)16(5)19(27)14(3)11-24(10-2,31-8)12-15(4)20(28)22(6,25)13-18(26)32-17/h10,14-17,21,29-30H,2,9,11-13H2,1,3-8H3/t14-,15-,16+,17-,21-,22-,23-,24-/m1/s1 |
| InChIKey | LMKDGSOVTVYDLJ-DUYFBXNXSA-N |
| XLogP | 2.95 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|