C13H18FN3S — CID 129313077
5-[(2Z,4Z)-4-[(2S)-2-amino-3-fluoropropyl]hepta-2,4,6-trienyl]-1,3-thiazol-2-amine (PubChem CID 129313077) has the molecular formula C13H18FN3S and a molecular weight of 267.37 g/mol. Its IUPAC name is 5-[(2Z,4Z)-4-[(2S)-2-amino-3-fluoropropyl]hepta-2,4,6-trienyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(2Z,4Z)-4-[(2S)-2-amino-3-fluoropropyl]hepta-2,4,6-trienyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 129313077 |
| Molecular Formula | C13H18FN3S |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 5-[(2Z,4Z)-4-[(2S)-2-amino-3-fluoropropyl]hepta-2,4,6-trienyl]-1,3-thiazol-2-amine |
| SMILES | C=C/C=C(\C=C/Cc1cnc(N)s1)C[C@H](N)CF |
| InChI | InChI=1S/C13H18FN3S/c1-2-4-10(7-11(15)8-14)5-3-6-12-9-17-13(16)18-12/h2-5,9,11H,1,6-8,15H2,(H2,16,17)/b5-3-,10-4+/t11-/m0/s1 |
| InChIKey | KEGCUVSEWIXHMG-VIHJRDCHSA-N |
| XLogP | 2.62 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|