About 2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol
2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol (PubChem CID 129313086) has the molecular formula C13H24FNO2S
and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol.
Molecular Properties
| Compound Name | 2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol |
| PubChem CID | 129313086 |
| Molecular Formula | C13H24FNO2S |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol |
| SMILES | CC/C=C(\C=C/CSCCO)C(OC)C(N)CF |
| InChI | InChI=1S/C13H24FNO2S/c1-3-5-11(6-4-8-18-9-7-16)13(17-2)12(15)10-14/h4-6,12-13,16H,3,7-10,15H2,1-2H3/b6-4-,11-5+ |
| InChIKey | KCQVBYZSEQXSQA-NQTKGXIKSA-N |
| XLogP | 1.92 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol?
The IUPAC name of 2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol (CID 129313086) is 2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol.
What is the SMILES notation for 2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol?
The canonical SMILES for 2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol is CC/C=C(\C=C/CSCCO)C(OC)C(N)CF.
What is the InChIKey of 2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol?
The InChIKey is KCQVBYZSEQXSQA-NQTKGXIKSA-N. The full InChI is InChI=1S/C13H24FNO2S/c1-3-5-11(6-4-8-18-9-7-16)13(17-2)12(15)10-14/h4-6,12-13,16H,3,7-10,15H2,1-2H3/b6-4-,11-5+.
What are the key properties of 2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol?
2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol has a molecular weight of 277.41 g/mol, XLogP of 1.92, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2Z,4E)-4-(2-amino-3-fluoro-1-methoxypropyl)hepta-2,4-dienyl]sulfanylethanol is sourced from PubChem (CID 129313086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).