About 4,5,6-tris(ethenyl)triazine;hydrofluoride
4,5,6-tris(ethenyl)triazine;hydrofluoride (PubChem CID 129313141) has the molecular formula C9H10FN3
and a molecular weight of 179.20 g/mol. Its IUPAC name is 4,5,6-tris(ethenyl)triazine;hydrofluoride.
Molecular Properties
| Compound Name | 4,5,6-tris(ethenyl)triazine;hydrofluoride |
| PubChem CID | 129313141 |
| Molecular Formula | C9H10FN3 |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4,5,6-tris(ethenyl)triazine;hydrofluoride |
| SMILES | C=Cc1nnnc(C=C)c1C=C.F |
| InChI | InChI=1S/C9H9N3.FH/c1-4-7-8(5-2)10-12-11-9(7)6-3;/h4-6H,1-3H2;1H |
| InChIKey | OFVSEXFRXYIDHL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5,6-tris(ethenyl)triazine;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6-tris(ethenyl)triazine;hydrofluoride?
The IUPAC name of 4,5,6-tris(ethenyl)triazine;hydrofluoride (CID 129313141) is 4,5,6-tris(ethenyl)triazine;hydrofluoride.
What is the SMILES notation for 4,5,6-tris(ethenyl)triazine;hydrofluoride?
The canonical SMILES for 4,5,6-tris(ethenyl)triazine;hydrofluoride is C=Cc1nnnc(C=C)c1C=C.F.
What is the InChIKey of 4,5,6-tris(ethenyl)triazine;hydrofluoride?
The InChIKey is OFVSEXFRXYIDHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3.FH/c1-4-7-8(5-2)10-12-11-9(7)6-3;/h4-6H,1-3H2;1H.
What are the key properties of 4,5,6-tris(ethenyl)triazine;hydrofluoride?
4,5,6-tris(ethenyl)triazine;hydrofluoride has a molecular weight of 179.20 g/mol, XLogP of 1.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6-tris(ethenyl)triazine;hydrofluoride is sourced from PubChem (CID 129313141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).