C18H20N4 — CID 129313201
3-ethenyl-4-[1-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]pyrazol-4-yl]pyridin-2-amine (PubChem CID 129313201) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 3-ethenyl-4-[1-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]pyrazol-4-yl]pyridin-2-amine.
| Compound Name | 3-ethenyl-4-[1-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]pyrazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 129313201 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 3-ethenyl-4-[1-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]pyrazol-4-yl]pyridin-2-amine |
| SMILES | C=C/C=C\C=C(/C)Cn1cc(-c2ccnc(N)c2C=C)cn1 |
| InChI | InChI=1S/C18H20N4/c1-4-6-7-8-14(3)12-22-13-15(11-21-22)17-9-10-20-18(19)16(17)5-2/h4-11,13H,1-2,12H2,3H3,(H2,19,20)/b7-6-,14-8+ |
| InChIKey | CKGGEERETIGECP-BHWOWGIZSA-N |
| XLogP | 3.86 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|