C15H25FN2OS — CID 129313204
methyl N'-[(1E,4Z,6E)-6-ethylidene-9-fluoro-7-methoxy-3-methylnona-1,4-dienyl]carbamimidothioate (PubChem CID 129313204) has the molecular formula C15H25FN2OS and a molecular weight of 300.44 g/mol. Its IUPAC name is methyl N'-[(1E,4Z,6E)-6-ethylidene-9-fluoro-7-methoxy-3-methylnona-1,4-dienyl]carbamimidothioate.
| Compound Name | methyl N'-[(1E,4Z,6E)-6-ethylidene-9-fluoro-7-methoxy-3-methylnona-1,4-dienyl]carbamimidothioate |
|---|---|
| PubChem CID | 129313204 |
| Molecular Formula | C15H25FN2OS |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | methyl N'-[(1E,4Z,6E)-6-ethylidene-9-fluoro-7-methoxy-3-methylnona-1,4-dienyl]carbamimidothioate |
| SMILES | C/C=C(\C=C/C(C)/C=C/N=C(/N)SC)C(CCF)OC |
| InChI | InChI=1S/C15H25FN2OS/c1-5-13(14(19-3)8-10-16)7-6-12(2)9-11-18-15(17)20-4/h5-7,9,11-12,14H,8,10H2,1-4H3,(H2,17,18)/b7-6-,11-9+,13-5+ |
| InChIKey | DDMRMHFBOWRSJE-QLYAFDPYSA-N |
| XLogP | 3.69 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|