About (4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine
(4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine (PubChem CID 129313230) has the molecular formula C16H26FNO2S
and a molecular weight of 315.45 g/mol. Its IUPAC name is (4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine.
Molecular Properties
| Compound Name | (4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine |
| PubChem CID | 129313230 |
| Molecular Formula | C16H26FNO2S |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | (4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine |
| SMILES | C=C/C=C(\C=C/CS(=O)CC1CCOCC1)CC(N)CF |
| InChI | InChI=1S/C16H26FNO2S/c1-2-4-14(11-16(18)12-17)5-3-10-21(19)13-15-6-8-20-9-7-15/h2-5,15-16H,1,6-13,18H2/b5-3-,14-4+ |
| InChIKey | JIJJLHOEOAJHHY-NUTJIFLOSA-N |
| XLogP | 2.52 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine?
The IUPAC name of (4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine (CID 129313230) is (4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine.
What is the SMILES notation for (4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine?
The canonical SMILES for (4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine is C=C/C=C(\C=C/CS(=O)CC1CCOCC1)CC(N)CF.
What is the InChIKey of (4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine?
The InChIKey is JIJJLHOEOAJHHY-NUTJIFLOSA-N. The full InChI is InChI=1S/C16H26FNO2S/c1-2-4-14(11-16(18)12-17)5-3-10-21(19)13-15-6-8-20-9-7-15/h2-5,15-16H,1,6-13,18H2/b5-3-,14-4+.
What are the key properties of (4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine?
(4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine has a molecular weight of 315.45 g/mol, XLogP of 2.52, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-1-fluoro-4-[(Z)-3-(oxan-4-ylmethylsulfinyl)prop-1-enyl]hepta-4,6-dien-2-amine is sourced from PubChem (CID 129313230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).