About (Z)-4-N-methylbut-1-ene-1,2,4-triamine
(Z)-4-N-methylbut-1-ene-1,2,4-triamine (PubChem CID 129313260) has the molecular formula C5H13N3
and a molecular weight of 115.18 g/mol. Its IUPAC name is (Z)-4-N-methylbut-1-ene-1,2,4-triamine.
Molecular Properties
| Compound Name | (Z)-4-N-methylbut-1-ene-1,2,4-triamine |
| PubChem CID | 129313260 |
| Molecular Formula | C5H13N3 |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.11 |
| IUPAC Name | (Z)-4-N-methylbut-1-ene-1,2,4-triamine |
| SMILES | CNCC/C(N)=C/N |
| InChI | InChI=1S/C5H13N3/c1-8-3-2-5(7)4-6/h4,8H,2-3,6-7H2,1H3/b5-4- |
| InChIKey | KBKSZBAAKICBHQ-PLNGDYQASA-N |
| XLogP | -0.65 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-4-N-methylbut-1-ene-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-N-methylbut-1-ene-1,2,4-triamine?
The IUPAC name of (Z)-4-N-methylbut-1-ene-1,2,4-triamine (CID 129313260) is (Z)-4-N-methylbut-1-ene-1,2,4-triamine.
What is the SMILES notation for (Z)-4-N-methylbut-1-ene-1,2,4-triamine?
The canonical SMILES for (Z)-4-N-methylbut-1-ene-1,2,4-triamine is CNCC/C(N)=C/N.
What is the InChIKey of (Z)-4-N-methylbut-1-ene-1,2,4-triamine?
The InChIKey is KBKSZBAAKICBHQ-PLNGDYQASA-N. The full InChI is InChI=1S/C5H13N3/c1-8-3-2-5(7)4-6/h4,8H,2-3,6-7H2,1H3/b5-4-.
What are the key properties of (Z)-4-N-methylbut-1-ene-1,2,4-triamine?
(Z)-4-N-methylbut-1-ene-1,2,4-triamine has a molecular weight of 115.18 g/mol, XLogP of -0.65, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-N-methylbut-1-ene-1,2,4-triamine is sourced from PubChem (CID 129313260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).