About N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide
N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide (PubChem CID 129313292) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide |
| PubChem CID | 129313292 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide |
| SMILES | CC(=O)N/C(=C/C=C(\C)N(C)C)C(C)C |
| InChI | InChI=1S/C12H22N2O/c1-9(2)12(13-11(4)15)8-7-10(3)14(5)6/h7-9H,1-6H3,(H,13,15)/b10-7+,12-8+ |
| InChIKey | VOMFTTISZKJXDU-SMTGYRLFSA-N |
| XLogP | 2.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide?
The IUPAC name of N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide (CID 129313292) is N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide.
What is the SMILES notation for N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide?
The canonical SMILES for N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide is CC(=O)N/C(=C/C=C(\C)N(C)C)C(C)C.
What is the InChIKey of N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide?
The InChIKey is VOMFTTISZKJXDU-SMTGYRLFSA-N. The full InChI is InChI=1S/C12H22N2O/c1-9(2)12(13-11(4)15)8-7-10(3)14(5)6/h7-9H,1-6H3,(H,13,15)/b10-7+,12-8+.
What are the key properties of N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide?
N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide has a molecular weight of 210.32 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E,5E)-6-(dimethylamino)-2-methylhepta-3,5-dien-3-yl]acetamide is sourced from PubChem (CID 129313292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).