C15H26NOPS — CID 129313471
(Z,4Z)-4-ethylidene-7-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)-1-phosphanyloct-5-en-2-amine (PubChem CID 129313471) has the molecular formula C15H26NOPS and a molecular weight of 299.42 g/mol. Its IUPAC name is (Z,4Z)-4-ethylidene-7-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)-1-phosphanyloct-5-en-2-amine.
| Compound Name | (Z,4Z)-4-ethylidene-7-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)-1-phosphanyloct-5-en-2-amine |
|---|---|
| PubChem CID | 129313471 |
| Molecular Formula | C15H26NOPS |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (Z,4Z)-4-ethylidene-7-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)-1-phosphanyloct-5-en-2-amine |
| SMILES | C/C=C(\C=C/C(C)C1=CCS(=O)CC1)CC(N)CP |
| InChI | InChI=1S/C15H26NOPS/c1-3-13(10-15(16)11-18)5-4-12(2)14-6-8-19(17)9-7-14/h3-6,12,15H,7-11,16,18H2,1-2H3/b5-4-,13-3+ |
| InChIKey | RVWNTVIUEKDLNZ-BNXXKACXSA-N |
| XLogP | 2.80 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|