About 4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran
4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran (PubChem CID 129313581) has the molecular formula C15H19FOS
and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran.
Molecular Properties
| Compound Name | 4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran |
| PubChem CID | 129313581 |
| Molecular Formula | C15H19FOS |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran |
| SMILES | COC(CCF)c1ccc(C2=CCSCC2)cc1 |
| InChI | InChI=1S/C15H19FOS/c1-17-15(6-9-16)14-4-2-12(3-5-14)13-7-10-18-11-8-13/h2-5,7,15H,6,8-11H2,1H3 |
| InChIKey | WAPFAELDXANEFU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran?
The IUPAC name of 4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran (CID 129313581) is 4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran.
What is the SMILES notation for 4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran?
The canonical SMILES for 4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran is COC(CCF)c1ccc(C2=CCSCC2)cc1.
What is the InChIKey of 4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran?
The InChIKey is WAPFAELDXANEFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FOS/c1-17-15(6-9-16)14-4-2-12(3-5-14)13-7-10-18-11-8-13/h2-5,7,15H,6,8-11H2,1H3.
What are the key properties of 4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran?
4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran has a molecular weight of 266.38 g/mol, XLogP of 4.25, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3-fluoro-1-methoxypropyl)phenyl]-3,6-dihydro-2H-thiopyran is sourced from PubChem (CID 129313581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).