About (Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine
(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine (PubChem CID 129313631) has the molecular formula C11H21FN2O
and a molecular weight of 216.30 g/mol. Its IUPAC name is (Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine.
Molecular Properties
| Compound Name | (Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine |
| PubChem CID | 129313631 |
| Molecular Formula | C11H21FN2O |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine |
| SMILES | C/C=C(\C=C/CCN)C(OC)C(N)CF |
| InChI | InChI=1S/C11H21FN2O/c1-3-9(6-4-5-7-13)11(15-2)10(14)8-12/h3-4,6,10-11H,5,7-8,13-14H2,1-2H3/b6-4-,9-3+ |
| InChIKey | VKKDQHPOQKKYDA-ALQLSLDWSA-N |
| XLogP | 1.15 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine?
The IUPAC name of (Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine (CID 129313631) is (Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine.
What is the SMILES notation for (Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine?
The canonical SMILES for (Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine is C/C=C(\C=C/CCN)C(OC)C(N)CF.
What is the InChIKey of (Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine?
The InChIKey is VKKDQHPOQKKYDA-ALQLSLDWSA-N. The full InChI is InChI=1S/C11H21FN2O/c1-3-9(6-4-5-7-13)11(15-2)10(14)8-12/h3-4,6,10-11H,5,7-8,13-14H2,1-2H3/b6-4-,9-3+.
What are the key properties of (Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine?
(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine has a molecular weight of 216.30 g/mol, XLogP of 1.15, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine is sourced from PubChem (CID 129313631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).