C16H25FO2S — CID 129313854
(3Z,5Z,8E)-10-ethylsulfonyl-4-(3-fluoro-2-methylpropyl)deca-1,3,5,8-tetraene (PubChem CID 129313854) has the molecular formula C16H25FO2S and a molecular weight of 300.44 g/mol. Its IUPAC name is (3Z,5Z,8E)-10-ethylsulfonyl-4-(3-fluoro-2-methylpropyl)deca-1,3,5,8-tetraene.
| Compound Name | (3Z,5Z,8E)-10-ethylsulfonyl-4-(3-fluoro-2-methylpropyl)deca-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 129313854 |
| Molecular Formula | C16H25FO2S |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (3Z,5Z,8E)-10-ethylsulfonyl-4-(3-fluoro-2-methylpropyl)deca-1,3,5,8-tetraene |
| SMILES | C=C/C=C(\C=C/C/C=C/CS(=O)(=O)CC)CC(C)CF |
| InChI | InChI=1S/C16H25FO2S/c1-4-10-16(13-15(3)14-17)11-8-6-7-9-12-20(18,19)5-2/h4,7-11,15H,1,5-6,12-14H2,2-3H3/b9-7+,11-8-,16-10+ |
| InChIKey | RGQDDNOWRDTUME-FNLOEUOQSA-N |
| XLogP | 4.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|