C13H21F2NOS — CID 129313857
(4E,5Z)-4-ethylidene-1-fluoro-7-(2-fluoroethylsulfanyl)-3-methoxyocta-5,7-dien-2-amine (PubChem CID 129313857) has the molecular formula C13H21F2NOS and a molecular weight of 277.38 g/mol. Its IUPAC name is (4E,5Z)-4-ethylidene-1-fluoro-7-(2-fluoroethylsulfanyl)-3-methoxyocta-5,7-dien-2-amine.
| Compound Name | (4E,5Z)-4-ethylidene-1-fluoro-7-(2-fluoroethylsulfanyl)-3-methoxyocta-5,7-dien-2-amine |
|---|---|
| PubChem CID | 129313857 |
| Molecular Formula | C13H21F2NOS |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (4E,5Z)-4-ethylidene-1-fluoro-7-(2-fluoroethylsulfanyl)-3-methoxyocta-5,7-dien-2-amine |
| SMILES | C=C(/C=C\C(=C/C)C(OC)C(N)CF)SCCF |
| InChI | InChI=1S/C13H21F2NOS/c1-4-11(13(17-3)12(16)9-15)6-5-10(2)18-8-7-14/h4-6,12-13H,2,7-9,16H2,1,3H3/b6-5-,11-4+ |
| InChIKey | PGQHNKWCFCSZTQ-VWXLBWAMSA-N |
| XLogP | 3.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|