C15H27F3N2 — CID 129313875
(Z,5Z)-2-N-(2,2-difluorobutyl)-5-ethylidene-8-fluoro-2-N-methyloct-3-ene-2,7-diamine (PubChem CID 129313875) has the molecular formula C15H27F3N2 and a molecular weight of 292.39 g/mol. Its IUPAC name is (Z,5Z)-2-N-(2,2-difluorobutyl)-5-ethylidene-8-fluoro-2-N-methyloct-3-ene-2,7-diamine.
| Compound Name | (Z,5Z)-2-N-(2,2-difluorobutyl)-5-ethylidene-8-fluoro-2-N-methyloct-3-ene-2,7-diamine |
|---|---|
| PubChem CID | 129313875 |
| Molecular Formula | C15H27F3N2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | (Z,5Z)-2-N-(2,2-difluorobutyl)-5-ethylidene-8-fluoro-2-N-methyloct-3-ene-2,7-diamine |
| SMILES | C/C=C(\C=C/C(C)N(C)CC(F)(F)CC)CC(N)CF |
| InChI | InChI=1S/C15H27F3N2/c1-5-13(9-14(19)10-16)8-7-12(3)20(4)11-15(17,18)6-2/h5,7-8,12,14H,6,9-11,19H2,1-4H3/b8-7-,13-5+ |
| InChIKey | QWZRGUWMYOBNNS-XYGSGGKESA-N |
| XLogP | 3.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|