C20H18Cl4O6 — CID 129314851
(1R)-1-[(4R,4aR,8aS)-2-(2,3-dichlorophenyl)-6-(3,4-dichlorophenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol (PubChem CID 129314851) has the molecular formula C20H18Cl4O6 and a molecular weight of 496.17 g/mol. Its IUPAC name is (1R)-1-[(4R,4aR,8aS)-2-(2,3-dichlorophenyl)-6-(3,4-dichlorophenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(4R,4aR,8aS)-2-(2,3-dichlorophenyl)-6-(3,4-dichlorophenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 129314851 |
| Molecular Formula | C20H18Cl4O6 |
| Molecular Weight | 496.17 g/mol |
| Exact Mass | 493.99 |
| IUPAC Name | (1R)-1-[(4R,4aR,8aS)-2-(2,3-dichlorophenyl)-6-(3,4-dichlorophenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol |
| SMILES | OC[C@@H](O)[C@H]1OC(c2cccc(Cl)c2Cl)O[C@H]2COC(c3ccc(Cl)c(Cl)c3)O[C@@H]12 |
| InChI | InChI=1S/C20H18Cl4O6/c21-11-5-4-9(6-13(11)23)19-27-8-15-18(30-19)17(14(26)7-25)29-20(28-15)10-2-1-3-12(22)16(10)24/h1-6,14-15,17-20,25-26H,7-8H2/t14-,15+,17-,18-,19?,20?/m1/s1 |
| InChIKey | XUYMRTNEQQHKLT-JVSRMZDRSA-N |
| XLogP | 4.55 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.17 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |