C6H14O2 — CID 12931505
(2R,4R)-2-methylpentane-1,4-diol (PubChem CID 12931505) has the molecular formula C6H14O2 and a molecular weight of 118.18 g/mol. Its IUPAC name is (2R,4R)-2-methylpentane-1,4-diol.
| Compound Name | (2R,4R)-2-methylpentane-1,4-diol |
|---|---|
| PubChem CID | 12931505 |
| Molecular Formula | C6H14O2 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.10 |
| IUPAC Name | (2R,4R)-2-methylpentane-1,4-diol |
| SMILES | C[C@@H](CO)C[C@@H](C)O |
| InChI | InChI=1S/C6H14O2/c1-5(4-7)3-6(2)8/h5-8H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | PNJNLCNHYSWUPT-PHDIDXHHSA-N |
| XLogP | 0.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |