C24H33F3N2O11S — CID 129315145
[(2R,3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate;trifluoromethanesulfonate (PubChem CID 129315145) has the molecular formula C24H33F3N2O11S and a molecular weight of 614.59 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate;trifluoromethanesulfonate.
| Compound Name | [(2R,3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 129315145 |
| Molecular Formula | C24H33F3N2O11S |
| Molecular Weight | 614.59 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate;trifluoromethanesulfonate |
| SMILES | CC(C)C(=O)OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H](OC(=O)C(C)C)[C@@H]1OC(=O)C(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C23H32N2O8.CHF3O3S/c1-12(2)21(27)30-11-16-17(32-22(28)13(3)4)18(33-23(29)14(5)6)20(31-16)25-9-7-8-15(10-25)19(24)26;2-1(3,4)8(5,6)7/h7-10,12-14,16-18,20H,11H2,1-6H3,(H-,24,26);(H,5,6,7)/t16-,17-,18-,20-;/m1./s1 |
| InChIKey | VNZQCRGTYFUOKZ-XLZRZFRKSA-N |
| XLogP | 1.36 |
| TPSA | 192.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.59 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|