C23H20ClF4NO5 — CID 129315146
[4-[[3-chloro-5-(trifluoromethoxy)phenoxy]methyl]-5-cyclopropyl-2-fluorobenzoyl] pyrrolidine-2-carboxylate (PubChem CID 129315146) has the molecular formula C23H20ClF4NO5 and a molecular weight of 501.86 g/mol. Its IUPAC name is [4-[[3-chloro-5-(trifluoromethoxy)phenoxy]methyl]-5-cyclopropyl-2-fluorobenzoyl] pyrrolidine-2-carboxylate.
| Compound Name | [4-[[3-chloro-5-(trifluoromethoxy)phenoxy]methyl]-5-cyclopropyl-2-fluorobenzoyl] pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 129315146 |
| Molecular Formula | C23H20ClF4NO5 |
| Molecular Weight | 501.86 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | [4-[[3-chloro-5-(trifluoromethoxy)phenoxy]methyl]-5-cyclopropyl-2-fluorobenzoyl] pyrrolidine-2-carboxylate |
| SMILES | O=C(OC(=O)C1CCCN1)c1cc(C2CC2)c(COc2cc(Cl)cc(OC(F)(F)F)c2)cc1F |
| InChI | InChI=1S/C23H20ClF4NO5/c24-14-7-15(9-16(8-14)34-23(26,27)28)32-11-13-6-19(25)18(10-17(13)12-3-4-12)21(30)33-22(31)20-2-1-5-29-20/h6-10,12,20,29H,1-5,11H2 |
| InChIKey | MQPSHHPSJFEXJW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.86 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|