C21H27F3N2O11S — CID 129315241
[(2R,3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate;trifluoromethanesulfonate (PubChem CID 129315241) has the molecular formula C21H27F3N2O11S and a molecular weight of 572.51 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate;trifluoromethanesulfonate.
| Compound Name | [(2R,3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 129315241 |
| Molecular Formula | C21H27F3N2O11S |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate;trifluoromethanesulfonate |
| SMILES | CCC(=O)OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H](OC(=O)CC)[C@@H]1OC(=O)CC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C20H26N2O8.CHF3O3S/c1-4-14(23)27-11-13-17(29-15(24)5-2)18(30-16(25)6-3)20(28-13)22-9-7-8-12(10-22)19(21)26;2-1(3,4)8(5,6)7/h7-10,13,17-18,20H,4-6,11H2,1-3H3,(H-,21,26);(H,5,6,7)/t13-,17-,18-,20-;/m1./s1 |
| InChIKey | GFMVPTUYOJJZQL-GSHYPCMZSA-N |
| XLogP | 0.62 |
| TPSA | 192.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|