C23H32ClN3O4S — CID 129316000
1-[4-chloro-3-(1-cyclobutyl-4-methylpiperidin-4-yl)sulfonyl-2-hydroxyphenyl]-3-[(1R)-2-methylcyclopent-2-en-1-yl]urea (PubChem CID 129316000) has the molecular formula C23H32ClN3O4S and a molecular weight of 482.05 g/mol. Its IUPAC name is 1-[4-chloro-3-(1-cyclobutyl-4-methylpiperidin-4-yl)sulfonyl-2-hydroxyphenyl]-3-[(1R)-2-methylcyclopent-2-en-1-yl]urea.
| Compound Name | 1-[4-chloro-3-(1-cyclobutyl-4-methylpiperidin-4-yl)sulfonyl-2-hydroxyphenyl]-3-[(1R)-2-methylcyclopent-2-en-1-yl]urea |
|---|---|
| PubChem CID | 129316000 |
| Molecular Formula | C23H32ClN3O4S |
| Molecular Weight | 482.05 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 1-[4-chloro-3-(1-cyclobutyl-4-methylpiperidin-4-yl)sulfonyl-2-hydroxyphenyl]-3-[(1R)-2-methylcyclopent-2-en-1-yl]urea |
| SMILES | CC1=CCC[C@H]1NC(=O)Nc1ccc(Cl)c(S(=O)(=O)C2(C)CCN(C3CCC3)CC2)c1O |
| InChI | InChI=1S/C23H32ClN3O4S/c1-15-5-3-8-18(15)25-22(29)26-19-10-9-17(24)21(20(19)28)32(30,31)23(2)11-13-27(14-12-23)16-6-4-7-16/h5,9-10,16,18,28H,3-4,6-8,11-14H2,1-2H3,(H2,25,26,29)/t18-/m1/s1 |
| InChIKey | TZMOKLVFRUTZTK-GOSISDBHSA-N |
| XLogP | 4.46 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.05 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|