C18H20F3N3O4S — CID 129316019
1-[4-cyano-2-hydroxy-3-(1,1,1-trifluoro-2-methylpropan-2-yl)sulfonylphenyl]-3-(2-methylcyclopent-2-en-1-yl)urea (PubChem CID 129316019) has the molecular formula C18H20F3N3O4S and a molecular weight of 431.44 g/mol. Its IUPAC name is 1-[4-cyano-2-hydroxy-3-(1,1,1-trifluoro-2-methylpropan-2-yl)sulfonylphenyl]-3-(2-methylcyclopent-2-en-1-yl)urea.
| Compound Name | 1-[4-cyano-2-hydroxy-3-(1,1,1-trifluoro-2-methylpropan-2-yl)sulfonylphenyl]-3-(2-methylcyclopent-2-en-1-yl)urea |
|---|---|
| PubChem CID | 129316019 |
| Molecular Formula | C18H20F3N3O4S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 1-[4-cyano-2-hydroxy-3-(1,1,1-trifluoro-2-methylpropan-2-yl)sulfonylphenyl]-3-(2-methylcyclopent-2-en-1-yl)urea |
| SMILES | CC1=CCCC1NC(=O)Nc1ccc(C#N)c(S(=O)(=O)C(C)(C)C(F)(F)F)c1O |
| InChI | InChI=1S/C18H20F3N3O4S/c1-10-5-4-6-12(10)23-16(26)24-13-8-7-11(9-22)15(14(13)25)29(27,28)17(2,3)18(19,20)21/h5,7-8,12,25H,4,6H2,1-3H3,(H2,23,24,26) |
| InChIKey | MBADXXZSRUMMGK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|