About 3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine
3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine (PubChem CID 129316307) has the molecular formula C15H10F2N2O2
and a molecular weight of 288.25 g/mol. Its IUPAC name is 3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine |
| PubChem CID | 129316307 |
| Molecular Formula | C15H10F2N2O2 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine |
| SMILES | Fc1cc(F)cc(Oc2ccc3c(C4CC4)noc3n2)c1 |
| InChI | InChI=1S/C15H10F2N2O2/c16-9-5-10(17)7-11(6-9)20-13-4-3-12-14(8-1-2-8)19-21-15(12)18-13/h3-8H,1-2H2 |
| InChIKey | SSPHTZQQPXNFLO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine?
The IUPAC name of 3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine (CID 129316307) is 3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine.
What is the SMILES notation for 3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine?
The canonical SMILES for 3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine is Fc1cc(F)cc(Oc2ccc3c(C4CC4)noc3n2)c1.
What is the InChIKey of 3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine?
The InChIKey is SSPHTZQQPXNFLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F2N2O2/c16-9-5-10(17)7-11(6-9)20-13-4-3-12-14(8-1-2-8)19-21-15(12)18-13/h3-8H,1-2H2.
What are the key properties of 3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine?
3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine has a molecular weight of 288.25 g/mol, XLogP of 4.17, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-6-(3,5-difluorophenoxy)-[1,2]oxazolo[5,4-b]pyridine is sourced from PubChem (CID 129316307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).