C4H4N2O2 — CID 129318118
4,5-dideuterio-1,2-dihydropyridazine-3,6-dione (PubChem CID 129318118) has the molecular formula C4H4N2O2 and a molecular weight of 114.10 g/mol. Its IUPAC name is 4,5-dideuterio-1,2-dihydropyridazine-3,6-dione.
| Compound Name | 4,5-dideuterio-1,2-dihydropyridazine-3,6-dione |
|---|---|
| PubChem CID | 129318118 |
| Molecular Formula | C4H4N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | 4,5-dideuterio-1,2-dihydropyridazine-3,6-dione |
| SMILES | [2H]c1c([2H])c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C4H4N2O2/c7-3-1-2-4(8)6-5-3/h1-2H,(H,5,7)(H,6,8)/i1D,2D |
| InChIKey | BGRDGMRNKXEXQD-QDNHWIQGSA-N |
| XLogP | -0.94 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |