C23H29N3O3 — CID 129318553
2-[4-(3-benzo[b][1]benzazepin-11-ylpropyl)-1,4-dioxidopiperazine-1,4-diium-1-yl]ethanol (PubChem CID 129318553) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-[4-(3-benzo[b][1]benzazepin-11-ylpropyl)-1,4-dioxidopiperazine-1,4-diium-1-yl]ethanol.
| Compound Name | 2-[4-(3-benzo[b][1]benzazepin-11-ylpropyl)-1,4-dioxidopiperazine-1,4-diium-1-yl]ethanol |
|---|---|
| PubChem CID | 129318553 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 2-[4-(3-benzo[b][1]benzazepin-11-ylpropyl)-1,4-dioxidopiperazine-1,4-diium-1-yl]ethanol |
| SMILES | [O-][N+]1(CCO)CC[N+]([O-])(CCCN2c3ccccc3C=Cc3ccccc32)CC1 |
| InChI | InChI=1S/C23H29N3O3/c27-19-18-26(29)16-14-25(28,15-17-26)13-5-12-24-22-8-3-1-6-20(22)10-11-21-7-2-4-9-23(21)24/h1-4,6-11,27H,5,12-19H2 |
| InChIKey | OWQZRCANFCVUII-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|