About bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid
bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid (PubChem CID 129319481) has the molecular formula C22H42N4O10
and a molecular weight of 522.60 g/mol. Its IUPAC name is bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid.
Molecular Properties
| Compound Name | bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid |
| PubChem CID | 129319481 |
| Molecular Formula | C22H42N4O10 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@H](CN)C1.CC(C)(C)OC(=O)N1CCO[C@H](CN)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C10H20N2O3.C2H2O4/c2*1-10(2,3)15-9(13)12-4-5-14-8(6-11)7-12;3-1(4)2(5)6/h2*8H,4-7,11H2,1-3H3;(H,3,4)(H,5,6)/t2*8-;/m11./s1 |
| InChIKey | LYRCBJSQOOYSOJ-GGTCEIRZSA-N |
| XLogP | 0.32 |
| TPSA | 204.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid?
The IUPAC name of bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid (CID 129319481) is bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid.
What is the SMILES notation for bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid?
The canonical SMILES for bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid is CC(C)(C)OC(=O)N1CCO[C@H](CN)C1.CC(C)(C)OC(=O)N1CCO[C@H](CN)C1.O=C(O)C(=O)O.
What is the InChIKey of bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid?
The InChIKey is LYRCBJSQOOYSOJ-GGTCEIRZSA-N. The full InChI is InChI=1S/2C10H20N2O3.C2H2O4/c2*1-10(2,3)15-9(13)12-4-5-14-8(6-11)7-12;3-1(4)2(5)6/h2*8H,4-7,11H2,1-3H3;(H,3,4)(H,5,6)/t2*8-;/m11./s1.
What are the key properties of bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid?
bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid has a molecular weight of 522.60 g/mol, XLogP of 0.32, 2 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate);oxalic acid is sourced from PubChem (CID 129319481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).