About 2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride
2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride (PubChem CID 129319878) has the molecular formula C8H16Cl3N3
and a molecular weight of 260.60 g/mol. Its IUPAC name is 2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride.
Molecular Properties
| Compound Name | 2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride |
| PubChem CID | 129319878 |
| Molecular Formula | C8H16Cl3N3 |
| Molecular Weight | 260.60 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride |
| SMILES | Cc1cc(N(C)C)ncc1N.Cl.Cl.Cl |
| InChI | InChI=1S/C8H13N3.3ClH/c1-6-4-8(11(2)3)10-5-7(6)9;;;/h4-5H,9H2,1-3H3;3*1H |
| InChIKey | ZHWSSGHTIHNTSZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.60 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride?
The IUPAC name of 2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride (CID 129319878) is 2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride.
What is the SMILES notation for 2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride?
The canonical SMILES for 2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride is Cc1cc(N(C)C)ncc1N.Cl.Cl.Cl.
What is the InChIKey of 2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride?
The InChIKey is ZHWSSGHTIHNTSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3.3ClH/c1-6-4-8(11(2)3)10-5-7(6)9;;;/h4-5H,9H2,1-3H3;3*1H.
What are the key properties of 2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride?
2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride has a molecular weight of 260.60 g/mol, XLogP of 2.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N,4-trimethylpyridine-2,5-diamine;trihydrochloride is sourced from PubChem (CID 129319878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).